C15H22O3 — CID 172845448
6-(methoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydro-2H-chromene (PubChem CID 172845448) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 6-(methoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydro-2H-chromene.
| Compound Name | 6-(methoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 172845448 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 6-(methoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydro-2H-chromene |
| SMILES | COCOc1c(C)c(C)c2c(c1C)CCC(C)O2 |
| InChI | InChI=1S/C15H22O3/c1-9-6-7-13-12(4)14(17-8-16-5)10(2)11(3)15(13)18-9/h9H,6-8H2,1-5H3 |
| InChIKey | XIWLCZPXCGAPNF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|