C12H20N4Si — CID 172845510
N-[tert-butyl(dimethyl)silyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 172845510) has the molecular formula C12H20N4Si and a molecular weight of 248.41 g/mol. Its IUPAC name is N-[tert-butyl(dimethyl)silyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | N-[tert-butyl(dimethyl)silyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 172845510 |
| Molecular Formula | C12H20N4Si |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N-[tert-butyl(dimethyl)silyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CC(C)(C)[Si](C)(C)Nc1ncnn2cccc12 |
| InChI | InChI=1S/C12H20N4Si/c1-12(2,3)17(4,5)15-11-10-7-6-8-16(10)14-9-13-11/h6-9H,1-5H3,(H,13,14,15) |
| InChIKey | XJBVOHIMQGZDMF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|