About sodium;isothiocyanic acid;phenylphosphonic acid
sodium;isothiocyanic acid;phenylphosphonic acid (PubChem CID 172846333) has the molecular formula C7H7NNaO3PS
and a molecular weight of 239.17 g/mol. Its IUPAC name is sodium;isothiocyanic acid;phenylphosphonic acid.
Molecular Properties
| Compound Name | sodium;isothiocyanic acid;phenylphosphonic acid |
| PubChem CID | 172846333 |
| Molecular Formula | C7H7NNaO3PS |
| Molecular Weight | 239.17 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | sodium;isothiocyanic acid;phenylphosphonic acid |
| SMILES | N=C=S.O=P(O)(O)c1cc[c-]cc1.[Na+] |
| InChI | InChI=1S/C6H6O3P.CHNS.Na/c7-10(8,9)6-4-2-1-3-5-6;2-1-3;/h2-5H,(H2,7,8,9);2H;/q-1;;+1 |
| InChIKey | UTUBEZFTUIEEOE-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.17 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;isothiocyanic acid;phenylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;isothiocyanic acid;phenylphosphonic acid?
The IUPAC name of sodium;isothiocyanic acid;phenylphosphonic acid (CID 172846333) is sodium;isothiocyanic acid;phenylphosphonic acid.
What is the SMILES notation for sodium;isothiocyanic acid;phenylphosphonic acid?
The canonical SMILES for sodium;isothiocyanic acid;phenylphosphonic acid is N=C=S.O=P(O)(O)c1cc[c-]cc1.[Na+].
What is the InChIKey of sodium;isothiocyanic acid;phenylphosphonic acid?
The InChIKey is UTUBEZFTUIEEOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3P.CHNS.Na/c7-10(8,9)6-4-2-1-3-5-6;2-1-3;/h2-5H,(H2,7,8,9);2H;/q-1;;+1.
What are the key properties of sodium;isothiocyanic acid;phenylphosphonic acid?
sodium;isothiocyanic acid;phenylphosphonic acid has a molecular weight of 239.17 g/mol, XLogP of -2.04, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;isothiocyanic acid;phenylphosphonic acid is sourced from PubChem (CID 172846333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).