About 1-nitropropane;tetrahydrochloride
1-nitropropane;tetrahydrochloride (PubChem CID 172847373) has the molecular formula C3H11Cl4NO2
and a molecular weight of 234.94 g/mol. Its IUPAC name is 1-nitropropane;tetrahydrochloride.
Molecular Properties
| Compound Name | 1-nitropropane;tetrahydrochloride |
| PubChem CID | 172847373 |
| Molecular Formula | C3H11Cl4NO2 |
| Molecular Weight | 234.94 g/mol |
| Exact Mass | 232.95 |
| IUPAC Name | 1-nitropropane;tetrahydrochloride |
| SMILES | CCC[N+](=O)[O-].Cl.Cl.Cl.Cl |
| InChI | InChI=1S/C3H7NO2.4ClH/c1-2-3-4(5)6;;;;/h2-3H2,1H3;4*1H |
| InChIKey | XPLDJVJLAVKFBF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.94 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitropropane;tetrahydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitropropane;tetrahydrochloride?
The IUPAC name of 1-nitropropane;tetrahydrochloride (CID 172847373) is 1-nitropropane;tetrahydrochloride.
What is the SMILES notation for 1-nitropropane;tetrahydrochloride?
The canonical SMILES for 1-nitropropane;tetrahydrochloride is CCC[N+](=O)[O-].Cl.Cl.Cl.Cl.
What is the InChIKey of 1-nitropropane;tetrahydrochloride?
The InChIKey is XPLDJVJLAVKFBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.4ClH/c1-2-3-4(5)6;;;;/h2-3H2,1H3;4*1H.
What are the key properties of 1-nitropropane;tetrahydrochloride?
1-nitropropane;tetrahydrochloride has a molecular weight of 234.94 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitropropane;tetrahydrochloride is sourced from PubChem (CID 172847373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).