C18H33FN2 — CID 172847712
3-fluoro-4-N,4-dihexylcyclohexa-1,5-diene-1,4-diamine (PubChem CID 172847712) has the molecular formula C18H33FN2 and a molecular weight of 296.47 g/mol. Its IUPAC name is 3-fluoro-4-N,4-dihexylcyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 3-fluoro-4-N,4-dihexylcyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 172847712 |
| Molecular Formula | C18H33FN2 |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | 3-fluoro-4-N,4-dihexylcyclohexa-1,5-diene-1,4-diamine |
| SMILES | CCCCCCNC1(CCCCCC)C=CC(N)=CC1F |
| InChI | InChI=1S/C18H33FN2/c1-3-5-7-9-12-18(21-14-10-8-6-4-2)13-11-16(20)15-17(18)19/h11,13,15,17,21H,3-10,12,14,20H2,1-2H3 |
| InChIKey | XQOYDZVVHPGBHJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|