C22H20N2 — CID 172847856
4,5-dimethyl-1-naphthalen-1-ylnaphthalene-2,3-diamine (PubChem CID 172847856) has the molecular formula C22H20N2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 4,5-dimethyl-1-naphthalen-1-ylnaphthalene-2,3-diamine.
| Compound Name | 4,5-dimethyl-1-naphthalen-1-ylnaphthalene-2,3-diamine |
|---|---|
| PubChem CID | 172847856 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 4,5-dimethyl-1-naphthalen-1-ylnaphthalene-2,3-diamine |
| SMILES | Cc1cccc2c(-c3cccc4ccccc34)c(N)c(N)c(C)c12 |
| InChI | InChI=1S/C22H20N2/c1-13-7-5-12-18-19(13)14(2)21(23)22(24)20(18)17-11-6-9-15-8-3-4-10-16(15)17/h3-12H,23-24H2,1-2H3 |
| InChIKey | XRCAUKWIEXOJKK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|