C6F9N3 — CID 172848058
4,5-difluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)triazine (PubChem CID 172848058) has the molecular formula C6F9N3 and a molecular weight of 285.07 g/mol. Its IUPAC name is 4,5-difluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)triazine.
| Compound Name | 4,5-difluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)triazine |
|---|---|
| PubChem CID | 172848058 |
| Molecular Formula | C6F9N3 |
| Molecular Weight | 285.07 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 4,5-difluoro-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)triazine |
| SMILES | Fc1nnnc(C(F)(C(F)(F)F)C(F)(F)F)c1F |
| InChI | InChI=1S/C6F9N3/c7-1-2(16-18-17-3(1)8)4(9,5(10,11)12)6(13,14)15 |
| InChIKey | XRTCOOSFMKFNTD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.07 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |