C38H36ClFN2O10 — CID 172848376
1-[(3S,4R)-3-[(3-chloro-5-fluorophenyl)methoxy]-3,4-dihydro-2H-chromen-4-yl]piperazine;dibenzoyl 2,3-dihydroxybutanedioate (PubChem CID 172848376) has the molecular formula C38H36ClFN2O10 and a molecular weight of 735.16 g/mol. Its IUPAC name is 1-[(3S,4R)-3-[(3-chloro-5-fluorophenyl)methoxy]-3,4-dihydro-2H-chromen-4-yl]piperazine;dibenzoyl 2,3-dihydroxybutanedioate.
| Compound Name | 1-[(3S,4R)-3-[(3-chloro-5-fluorophenyl)methoxy]-3,4-dihydro-2H-chromen-4-yl]piperazine;dibenzoyl 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 172848376 |
| Molecular Formula | C38H36ClFN2O10 |
| Molecular Weight | 735.16 g/mol |
| Exact Mass | 734.20 |
| IUPAC Name | 1-[(3S,4R)-3-[(3-chloro-5-fluorophenyl)methoxy]-3,4-dihydro-2H-chromen-4-yl]piperazine;dibenzoyl 2,3-dihydroxybutanedioate |
| SMILES | Fc1cc(Cl)cc(CO[C@@H]2COc3ccccc3[C@H]2N2CCNCC2)c1.O=C(OC(=O)C(O)C(O)C(=O)OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22ClFN2O2.C18H14O8/c21-15-9-14(10-16(22)11-15)12-25-19-13-26-18-4-2-1-3-17(18)20(19)24-7-5-23-6-8-24;19-13(17(23)25-15(21)11-7-3-1-4-8-11)14(20)18(24)26-16(22)12-9-5-2-6-10-12/h1-4,9-11,19-20,23H,5-8,12-13H2;1-10,13-14,19-20H/t19-,20-;/m1./s1 |
| InChIKey | XSSIQFHVIBVXPN-GZJHNZOKSA-N |
| XLogP | 3.88 |
| TPSA | 160.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.16 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|