About 7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole
7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole (PubChem CID 172848637) has the molecular formula C16H17NO
and a molecular weight of 239.32 g/mol. Its IUPAC name is 7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole.
Molecular Properties
| Compound Name | 7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole |
| PubChem CID | 172848637 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole |
| SMILES | c1cc2c([nH]1)-c1cc(OC3CCCC3)ccc1C2 |
| InChI | InChI=1S/C16H17NO/c1-2-4-13(3-1)18-14-6-5-11-9-12-7-8-17-16(12)15(11)10-14/h5-8,10,13,17H,1-4,9H2 |
| InChIKey | XTQDQABEKLDWAF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole?
The IUPAC name of 7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole (CID 172848637) is 7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole.
What is the SMILES notation for 7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole?
The canonical SMILES for 7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole is c1cc2c([nH]1)-c1cc(OC3CCCC3)ccc1C2.
What is the InChIKey of 7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole?
The InChIKey is XTQDQABEKLDWAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO/c1-2-4-13(3-1)18-14-6-5-11-9-12-7-8-17-16(12)15(11)10-14/h5-8,10,13,17H,1-4,9H2.
What are the key properties of 7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole?
7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole has a molecular weight of 239.32 g/mol, XLogP of 3.91, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclopentyloxy-1,4-dihydroindeno[1,2-b]pyrrole is sourced from PubChem (CID 172848637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).