About methylazanium;trimethylazanium;sulfate
methylazanium;trimethylazanium;sulfate (PubChem CID 172848902) has the molecular formula C4H16N2O4S
and a molecular weight of 188.25 g/mol. Its IUPAC name is methylazanium;trimethylazanium;sulfate.
Molecular Properties
| Compound Name | methylazanium;trimethylazanium;sulfate |
| PubChem CID | 172848902 |
| Molecular Formula | C4H16N2O4S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | methylazanium;trimethylazanium;sulfate |
| SMILES | C[NH+](C)C.C[NH3+].O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C3H9N.CH5N.H2O4S/c1-4(2)3;1-2;1-5(2,3)4/h1-3H3;2H2,1H3;(H2,1,2,3,4) |
| InChIKey | XUNOTVCHDSGWNA-UHFFFAOYSA-N |
| XLogP | -3.72 |
| TPSA | 112.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze methylazanium;trimethylazanium;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylazanium;trimethylazanium;sulfate?
The IUPAC name of methylazanium;trimethylazanium;sulfate (CID 172848902) is methylazanium;trimethylazanium;sulfate.
What is the SMILES notation for methylazanium;trimethylazanium;sulfate?
The canonical SMILES for methylazanium;trimethylazanium;sulfate is C[NH+](C)C.C[NH3+].O=S(=O)([O-])[O-].
What is the InChIKey of methylazanium;trimethylazanium;sulfate?
The InChIKey is XUNOTVCHDSGWNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.CH5N.H2O4S/c1-4(2)3;1-2;1-5(2,3)4/h1-3H3;2H2,1H3;(H2,1,2,3,4).
What are the key properties of methylazanium;trimethylazanium;sulfate?
methylazanium;trimethylazanium;sulfate has a molecular weight of 188.25 g/mol, XLogP of -3.72, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylazanium;trimethylazanium;sulfate is sourced from PubChem (CID 172848902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).