About disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride
disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride (PubChem CID 172849137) has the molecular formula C7H6Cl2FNNa2O2
and a molecular weight of 272.01 g/mol. Its IUPAC name is disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride.
Molecular Properties
| Compound Name | disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride |
| PubChem CID | 172849137 |
| Molecular Formula | C7H6Cl2FNNa2O2 |
| Molecular Weight | 272.01 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride |
| SMILES | COC(=O)c1cc(F)ccn1.[Cl-].[Cl-].[Na+].[Na+] |
| InChI | InChI=1S/C7H6FNO2.2ClH.2Na/c1-11-7(10)6-4-5(8)2-3-9-6;;;;/h2-4H,1H3;2*1H;;/q;;;2*+1/p-2 |
| InChIKey | XVFOMZWVLJWYIR-UHFFFAOYSA-L |
| XLogP | -10.98 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.01 |
| LogP ≤ 5 | -10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride?
The IUPAC name of disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride (CID 172849137) is disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride.
What is the SMILES notation for disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride?
The canonical SMILES for disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride is COC(=O)c1cc(F)ccn1.[Cl-].[Cl-].[Na+].[Na+].
What is the InChIKey of disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride?
The InChIKey is XVFOMZWVLJWYIR-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6FNO2.2ClH.2Na/c1-11-7(10)6-4-5(8)2-3-9-6;;;;/h2-4H,1H3;2*1H;;/q;;;2*+1/p-2.
What are the key properties of disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride?
disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride has a molecular weight of 272.01 g/mol, XLogP of -10.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;methyl 4-fluoropyridine-2-carboxylate;dichloride is sourced from PubChem (CID 172849137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).