C13H11B2F5O5 — CID 172849713
(2-methoxyphenyl)boronic acid;(2,3,4,5,6-pentafluorophenyl)boronic acid (PubChem CID 172849713) has the molecular formula C13H11B2F5O5 and a molecular weight of 363.84 g/mol. Its IUPAC name is (2-methoxyphenyl)boronic acid;(2,3,4,5,6-pentafluorophenyl)boronic acid.
| Compound Name | (2-methoxyphenyl)boronic acid;(2,3,4,5,6-pentafluorophenyl)boronic acid |
|---|---|
| PubChem CID | 172849713 |
| Molecular Formula | C13H11B2F5O5 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | (2-methoxyphenyl)boronic acid;(2,3,4,5,6-pentafluorophenyl)boronic acid |
| SMILES | COc1ccccc1B(O)O.OB(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7H9BO3.C6H2BF5O2/c1-11-7-5-3-2-4-6(7)8(9)10;8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h2-5,9-10H,1H3;13-14H |
| InChIKey | XXDAYXHKQVRFFN-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|