C23H27N3O3S — CID 17284992
3-[1-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-4-[2-(3,4-dimethoxyphenyl)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 17284992) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 3-[1-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-4-[2-(3,4-dimethoxyphenyl)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[1-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-4-[2-(3,4-dimethoxyphenyl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 17284992 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 3-[1-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-4-[2-(3,4-dimethoxyphenyl)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(CCn2c(C(C)Oc3ccc4c(c3)CCC4)n[nH]c2=S)cc1OC |
| InChI | InChI=1S/C23H27N3O3S/c1-15(29-19-9-8-17-5-4-6-18(17)14-19)22-24-25-23(30)26(22)12-11-16-7-10-20(27-2)21(13-16)28-3/h7-10,13-15H,4-6,11-12H2,1-3H3,(H,25,30) |
| InChIKey | PGJZEDCIVPDVPS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|