About 7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole
7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole (PubChem CID 17285093) has the molecular formula C16H22N4O3S
and a molecular weight of 350.44 g/mol. Its IUPAC name is 7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole.
Molecular Properties
| Compound Name | 7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole |
| PubChem CID | 17285093 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole |
| SMILES | O=S(=O)(c1ccc(N2CCCCC2)c2nonc12)N1CCCCC1 |
| InChI | InChI=1S/C16H22N4O3S/c21-24(22,20-11-5-2-6-12-20)14-8-7-13(15-16(14)18-23-17-15)19-9-3-1-4-10-19/h7-8H,1-6,9-12H2 |
| InChIKey | AXOPKBLDCWWYIC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole?
The IUPAC name of 7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole (CID 17285093) is 7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole.
What is the SMILES notation for 7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole?
The canonical SMILES for 7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole is O=S(=O)(c1ccc(N2CCCCC2)c2nonc12)N1CCCCC1.
What is the InChIKey of 7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole?
The InChIKey is AXOPKBLDCWWYIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O3S/c21-24(22,20-11-5-2-6-12-20)14-8-7-13(15-16(14)18-23-17-15)19-9-3-1-4-10-19/h7-8H,1-6,9-12H2.
What are the key properties of 7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole?
7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole has a molecular weight of 350.44 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-piperidin-1-yl-4-piperidin-1-ylsulfonyl-2,1,3-benzoxadiazole is sourced from PubChem (CID 17285093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).