C11H9N3Na2O7S — CID 172851277
disodium;(1R,8R)-4-hydroxy-10-oxo-11-sulfonatooxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboximidate (PubChem CID 172851277) has the molecular formula C11H9N3Na2O7S and a molecular weight of 373.25 g/mol. Its IUPAC name is disodium;(1R,8R)-4-hydroxy-10-oxo-11-sulfonatooxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboximidate.
| Compound Name | disodium;(1R,8R)-4-hydroxy-10-oxo-11-sulfonatooxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboximidate |
|---|---|
| PubChem CID | 172851277 |
| Molecular Formula | C11H9N3Na2O7S |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | disodium;(1R,8R)-4-hydroxy-10-oxo-11-sulfonatooxy-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboximidate |
| SMILES | [H]/N=C(\[O-])[C@H]1c2ccc(O)cc2[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C11H11N3O7S.2Na/c12-10(16)9-6-2-1-5(15)3-7(6)8-4-13(9)11(17)14(8)21-22(18,19)20;;/h1-3,8-9,15H,4H2,(H2,12,16)(H,18,19,20);;/q;2*+1/p-2/t8-,9+;;/m0../s1 |
| InChIKey | CAGIVMNWGBYXHH-DBEJOZALSA-L |
| XLogP | -7.04 |
| TPSA | 157.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | -7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|