C14H22N4O3S — CID 17285143
7-(diethylamino)-N,N-diethyl-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 17285143) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is 7-(diethylamino)-N,N-diethyl-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | 7-(diethylamino)-N,N-diethyl-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 17285143 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 7-(diethylamino)-N,N-diethyl-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N(CC)CC)c2nonc12 |
| InChI | InChI=1S/C14H22N4O3S/c1-5-17(6-2)11-9-10-12(14-13(11)15-21-16-14)22(19,20)18(7-3)8-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | YJPRNBFXFNUFMK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |