About 2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide
2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide (PubChem CID 172851850) has the molecular formula C23H34N4O2
and a molecular weight of 398.55 g/mol. Its IUPAC name is 2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide.
Molecular Properties
| Compound Name | 2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide |
| PubChem CID | 172851850 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide |
| SMILES | Cc1ccc2onc(N3CCN(CCC4CCC(C(C)C(N)=O)CC4)CC3)c2c1 |
| InChI | InChI=1S/C23H34N4O2/c1-16-3-8-21-20(15-16)23(25-29-21)27-13-11-26(12-14-27)10-9-18-4-6-19(7-5-18)17(2)22(24)28/h3,8,15,17-19H,4-7,9-14H2,1-2H3,(H2,24,28) |
| InChIKey | YEEGUJRJJQLDEH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide?
The IUPAC name of 2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide (CID 172851850) is 2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide.
What is the SMILES notation for 2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide?
The canonical SMILES for 2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide is Cc1ccc2onc(N3CCN(CCC4CCC(C(C)C(N)=O)CC4)CC3)c2c1.
What is the InChIKey of 2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide?
The InChIKey is YEEGUJRJJQLDEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H34N4O2/c1-16-3-8-21-20(15-16)23(25-29-21)27-13-11-26(12-14-27)10-9-18-4-6-19(7-5-18)17(2)22(24)28/h3,8,15,17-19H,4-7,9-14H2,1-2H3,(H2,24,28).
What are the key properties of 2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide?
2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide has a molecular weight of 398.55 g/mol, XLogP of 3.58, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-[4-(5-methyl-1,2-benzoxazol-3-yl)piperazin-1-yl]ethyl]cyclohexyl]propanamide is sourced from PubChem (CID 172851850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).