C24H34O6 — CID 172852152
(2S,3R,4R,5R,6S)-2-[[(8R,9S,13S,14S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]-6-methyloxane-3,4,5-triol (PubChem CID 172852152) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-[[(8R,9S,13S,14S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6S)-2-[[(8R,9S,13S,14S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 172852152 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[[(8R,9S,13S,14S)-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]-6-methyloxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@H](OC2CC[C@H]3[C@@H]4CCc5cc(O)ccc5[C@H]4CC[C@]23C)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H34O6/c1-12-20(26)21(27)22(28)23(29-12)30-19-8-7-18-17-5-3-13-11-14(25)4-6-15(13)16(17)9-10-24(18,19)2/h4,6,11-12,16-23,25-28H,3,5,7-10H2,1-2H3/t12-,16+,17+,18-,19?,20-,21+,22+,23+,24-/m0/s1 |
| InChIKey | YFECVKKLJUPYRJ-PDXZMRHKSA-N |
| XLogP | 2.46 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |