C14H28O — CID 172853495
3,3-diethyl-2,2-di(propan-2-yl)oxolane (PubChem CID 172853495) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is 3,3-diethyl-2,2-di(propan-2-yl)oxolane.
| Compound Name | 3,3-diethyl-2,2-di(propan-2-yl)oxolane |
|---|---|
| PubChem CID | 172853495 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 3,3-diethyl-2,2-di(propan-2-yl)oxolane |
| SMILES | CCC1(CC)CCOC1(C(C)C)C(C)C |
| InChI | InChI=1S/C14H28O/c1-7-13(8-2)9-10-15-14(13,11(3)4)12(5)6/h11-12H,7-10H2,1-6H3 |
| InChIKey | YJRGJUGMNKQIPP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |