C20H32O5 — CID 172853911
7-[(1S,2S)-2-(8,8,8-trihydroxyoctyl)cyclopentyl]hepta-2,4,6-trienoic acid (PubChem CID 172853911) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is 7-[(1S,2S)-2-(8,8,8-trihydroxyoctyl)cyclopentyl]hepta-2,4,6-trienoic acid.
| Compound Name | 7-[(1S,2S)-2-(8,8,8-trihydroxyoctyl)cyclopentyl]hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 172853911 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 7-[(1S,2S)-2-(8,8,8-trihydroxyoctyl)cyclopentyl]hepta-2,4,6-trienoic acid |
| SMILES | O=C(O)C=CC=CC=C[C@H]1CCC[C@@H]1CCCCCCCC(O)(O)O |
| InChI | InChI=1S/C20H32O5/c21-19(22)15-8-4-3-7-12-18-14-10-13-17(18)11-6-2-1-5-9-16-20(23,24)25/h3-4,7-8,12,15,17-18,23-25H,1-2,5-6,9-11,13-14,16H2,(H,21,22)/t17-,18-/m0/s1 |
| InChIKey | YLBCLAKBMFTFRV-ROUUACIJSA-N |
| XLogP | 3.52 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|