About 2-nitro-1H-imidazole;1,3-oxazolidin-2-one
2-nitro-1H-imidazole;1,3-oxazolidin-2-one (PubChem CID 172854121) has the molecular formula C6H8N4O4
and a molecular weight of 200.15 g/mol. Its IUPAC name is 2-nitro-1H-imidazole;1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 2-nitro-1H-imidazole;1,3-oxazolidin-2-one |
| PubChem CID | 172854121 |
| Molecular Formula | C6H8N4O4 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 2-nitro-1H-imidazole;1,3-oxazolidin-2-one |
| SMILES | O=C1NCCO1.O=[N+]([O-])c1ncc[nH]1 |
| InChI | InChI=1S/C3H3N3O2.C3H5NO2/c7-6(8)3-4-1-2-5-3;5-3-4-1-2-6-3/h1-2H,(H,4,5);1-2H2,(H,4,5) |
| InChIKey | YLSYPOKWVJYCCZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-1H-imidazole;1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-1H-imidazole;1,3-oxazolidin-2-one?
The IUPAC name of 2-nitro-1H-imidazole;1,3-oxazolidin-2-one (CID 172854121) is 2-nitro-1H-imidazole;1,3-oxazolidin-2-one.
What is the SMILES notation for 2-nitro-1H-imidazole;1,3-oxazolidin-2-one?
The canonical SMILES for 2-nitro-1H-imidazole;1,3-oxazolidin-2-one is O=C1NCCO1.O=[N+]([O-])c1ncc[nH]1.
What is the InChIKey of 2-nitro-1H-imidazole;1,3-oxazolidin-2-one?
The InChIKey is YLSYPOKWVJYCCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N3O2.C3H5NO2/c7-6(8)3-4-1-2-5-3;5-3-4-1-2-6-3/h1-2H,(H,4,5);1-2H2,(H,4,5).
What are the key properties of 2-nitro-1H-imidazole;1,3-oxazolidin-2-one?
2-nitro-1H-imidazole;1,3-oxazolidin-2-one has a molecular weight of 200.15 g/mol, XLogP of 0.04, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-1H-imidazole;1,3-oxazolidin-2-one is sourced from PubChem (CID 172854121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).