About CID 172854366
CID 172854366 (PubChem CID 172854366) has the molecular formula C2H4LiO5S
and a molecular weight of 147.06 g/mol.
Molecular Properties
| Compound Name | CID 172854366 |
| PubChem CID | 172854366 |
| Molecular Formula | C2H4LiO5S |
| Molecular Weight | 147.06 g/mol |
| Exact Mass | 146.99 |
| IUPAC Name | — |
| SMILES | O=S1(=O)OCCOO1.[Li] |
| InChI | InChI=1S/C2H4O5S.Li/c3-8(4)6-2-1-5-7-8;/h1-2H2; |
| InChIKey | YMOBQUVTZDPYSI-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.06 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 172854366 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172854366?
The IUPAC name of CID 172854366 (CID 172854366) is not available.
What is the SMILES notation for CID 172854366?
The canonical SMILES for CID 172854366 is O=S1(=O)OCCOO1.[Li].
What is the InChIKey of CID 172854366?
The InChIKey is YMOBQUVTZDPYSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O5S.Li/c3-8(4)6-2-1-5-7-8;/h1-2H2;.
What are the key properties of CID 172854366?
CID 172854366 has a molecular weight of 147.06 g/mol, XLogP of -1.17, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172854366 is sourced from PubChem (CID 172854366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).