About 2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid
2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid (PubChem CID 172855108) has the molecular formula C6H8F3N3O2
and a molecular weight of 211.14 g/mol. Its IUPAC name is 2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | 2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid |
| PubChem CID | 172855108 |
| Molecular Formula | C6H8F3N3O2 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid |
| SMILES | NN1C=CC=NC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C4H7N3.C2HF3O2/c5-7-3-1-2-6-4-7;3-2(4,5)1(6)7/h1-3H,4-5H2;(H,6,7) |
| InChIKey | YPAORJNWILZHBA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid?
The IUPAC name of 2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid (CID 172855108) is 2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid?
The canonical SMILES for 2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid is NN1C=CC=NC1.O=C(O)C(F)(F)F.
What is the InChIKey of 2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid?
The InChIKey is YPAORJNWILZHBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3.C2HF3O2/c5-7-3-1-2-6-4-7;3-2(4,5)1(6)7/h1-3H,4-5H2;(H,6,7).
What are the key properties of 2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid?
2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid has a molecular weight of 211.14 g/mol, XLogP of 0.35, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrimidin-1-amine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 172855108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).