About CID 172855166
CID 172855166 (PubChem CID 172855166) has the molecular formula C8H6NaO5S
and a molecular weight of 237.19 g/mol.
Molecular Properties
| Compound Name | CID 172855166 |
| PubChem CID | 172855166 |
| Molecular Formula | C8H6NaO5S |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | — |
| SMILES | O=C1OC(S(=O)(=O)O)c2ccccc21.[Na] |
| InChI | InChI=1S/C8H6O5S.Na/c9-7-5-3-1-2-4-6(5)8(13-7)14(10,11)12;/h1-4,8H,(H,10,11,12); |
| InChIKey | YPGMLXZEZDKSMJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 172855166 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172855166?
The IUPAC name of CID 172855166 (CID 172855166) is not available.
What is the SMILES notation for CID 172855166?
The canonical SMILES for CID 172855166 is O=C1OC(S(=O)(=O)O)c2ccccc21.[Na].
What is the InChIKey of CID 172855166?
The InChIKey is YPGMLXZEZDKSMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O5S.Na/c9-7-5-3-1-2-4-6(5)8(13-7)14(10,11)12;/h1-4,8H,(H,10,11,12);.
What are the key properties of CID 172855166?
CID 172855166 has a molecular weight of 237.19 g/mol, XLogP of 0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172855166 is sourced from PubChem (CID 172855166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).