C19H22F6N4O3 — CID 172855629
(1S,7R)-1,3,10,10-tetramethyl-4-[[5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]-3,4-diazatricyclo[5.2.1.02,6]dec-2(6)-en-5-one;2,2,2-trifluoroacetic acid (PubChem CID 172855629) has the molecular formula C19H22F6N4O3 and a molecular weight of 468.40 g/mol. Its IUPAC name is (1S,7R)-1,3,10,10-tetramethyl-4-[[5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]-3,4-diazatricyclo[5.2.1.02,6]dec-2(6)-en-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,7R)-1,3,10,10-tetramethyl-4-[[5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]-3,4-diazatricyclo[5.2.1.02,6]dec-2(6)-en-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 172855629 |
| Molecular Formula | C19H22F6N4O3 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | (1S,7R)-1,3,10,10-tetramethyl-4-[[5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]-3,4-diazatricyclo[5.2.1.02,6]dec-2(6)-en-5-one;2,2,2-trifluoroacetic acid |
| SMILES | Cn1c2c(c(=O)n1Cc1cn[nH]c1C(F)(F)F)[C@@H]1CC[C@@]2(C)C1(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H21F3N4O.C2HF3O2/c1-15(2)10-5-6-16(15,3)13-11(10)14(25)24(23(13)4)8-9-7-21-22-12(9)17(18,19)20;3-2(4,5)1(6)7/h7,10H,5-6,8H2,1-4H3,(H,21,22);(H,6,7)/t10-,16+;/m0./s1 |
| InChIKey | YQYDYYSZUIGUJQ-XVQZZTKGSA-N |
| XLogP | 3.79 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |