About 4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid
4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid (PubChem CID 172856128) has the molecular formula C23H20O6
and a molecular weight of 392.41 g/mol. Its IUPAC name is 4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid.
Molecular Properties
| Compound Name | 4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid |
| PubChem CID | 172856128 |
| Molecular Formula | C23H20O6 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid |
| SMILES | C=CCCOc1cccc2c1C(=O)c1c(OCCC=C)cc(C(=O)O)cc1C2=O |
| InChI | InChI=1S/C23H20O6/c1-3-5-10-28-17-9-7-8-15-19(17)22(25)20-16(21(15)24)12-14(23(26)27)13-18(20)29-11-6-4-2/h3-4,7-9,12-13H,1-2,5-6,10-11H2,(H,26,27) |
| InChIKey | YSQKIRJDQFTTSU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid?
The IUPAC name of 4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid (CID 172856128) is 4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid.
What is the SMILES notation for 4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid?
The canonical SMILES for 4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid is C=CCCOc1cccc2c1C(=O)c1c(OCCC=C)cc(C(=O)O)cc1C2=O.
What is the InChIKey of 4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid?
The InChIKey is YSQKIRJDQFTTSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20O6/c1-3-5-10-28-17-9-7-8-15-19(17)22(25)20-16(21(15)24)12-14(23(26)27)13-18(20)29-11-6-4-2/h3-4,7-9,12-13H,1-2,5-6,10-11H2,(H,26,27).
What are the key properties of 4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid?
4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid has a molecular weight of 392.41 g/mol, XLogP of 4.07, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(but-3-enoxy)-9,10-dioxoanthracene-2-carboxylic acid is sourced from PubChem (CID 172856128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).