About ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate
ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate (PubChem CID 172856892) has the molecular formula C21H23ClN2O4S
and a molecular weight of 434.95 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate |
| PubChem CID | 172856892 |
| Molecular Formula | C21H23ClN2O4S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)C1(C)CC(C)=C(c2ccc(Cl)cc2)N1c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H23ClN2O4S/c1-4-28-20(25)21(3)13-14(2)19(15-5-7-16(22)8-6-15)24(21)17-9-11-18(12-10-17)29(23,26)27/h5-12H,4,13H2,1-3H3,(H2,23,26,27) |
| InChIKey | YVDQHXFSUOWDNO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate?
The IUPAC name of ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate (CID 172856892) is ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate.
What is the SMILES notation for ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate?
The canonical SMILES for ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate is CCOC(=O)C1(C)CC(C)=C(c2ccc(Cl)cc2)N1c1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate?
The InChIKey is YVDQHXFSUOWDNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23ClN2O4S/c1-4-28-20(25)21(3)13-14(2)19(15-5-7-16(22)8-6-15)24(21)17-9-11-18(12-10-17)29(23,26)27/h5-12H,4,13H2,1-3H3,(H2,23,26,27).
What are the key properties of ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate?
ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate has a molecular weight of 434.95 g/mol, XLogP of 3.95, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(4-chlorophenyl)-2,4-dimethyl-1-(4-sulfamoylphenyl)-3H-pyrrole-2-carboxylate is sourced from PubChem (CID 172856892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).