C27H46O3Si — CID 172856934
ethyl (2E,4E)-5-[(1S,2R,4aS,6R,7S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylpenta-2,4-dienoate (PubChem CID 172856934) has the molecular formula C27H46O3Si and a molecular weight of 446.75 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[(1S,2R,4aS,6R,7S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[(1S,2R,4aS,6R,7S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 172856934 |
| Molecular Formula | C27H46O3Si |
| Molecular Weight | 446.75 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | ethyl (2E,4E)-5-[(1S,2R,4aS,6R,7S,8S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C/C=C/[C@@H]1[C@H]2[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@H]2C=C[C@H]1C |
| InChI | InChI=1S/C27H46O3Si/c1-11-29-26(28)19(3)13-12-14-23-18(2)15-16-22-17-20(4)25(21(5)24(22)23)30-31(9,10)27(6,7)8/h12-16,18,20-25H,11,17H2,1-10H3/b14-12+,19-13+/t18-,20-,21+,22-,23+,24+,25+/m1/s1 |
| InChIKey | YVIMZHMOWVZEGF-MZFDIPJNSA-N |
| XLogP | 7.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.75 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|