About ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate
ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate (PubChem CID 172857342) has the molecular formula C10H14N4O3
and a molecular weight of 238.25 g/mol. Its IUPAC name is ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate |
| PubChem CID | 172857342 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)N1C(C)=NC2=CN(O)NC2=C1C |
| InChI | InChI=1S/C10H14N4O3/c1-4-17-10(15)14-6(2)9-8(11-7(14)3)5-13(16)12-9/h5,12,16H,4H2,1-3H3 |
| InChIKey | YWVOTNVLZAMQRT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate?
The IUPAC name of ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate (CID 172857342) is ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate.
What is the SMILES notation for ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate?
The canonical SMILES for ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate is CCOC(=O)N1C(C)=NC2=CN(O)NC2=C1C.
What is the InChIKey of ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate?
The InChIKey is YWVOTNVLZAMQRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O3/c1-4-17-10(15)14-6(2)9-8(11-7(14)3)5-13(16)12-9/h5,12,16H,4H2,1-3H3.
What are the key properties of ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate?
ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate has a molecular weight of 238.25 g/mol, XLogP of 1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxy-5,7-dimethyl-1H-pyrazolo[4,3-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 172857342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).