C26H27FN4O3 — CID 172858172
tert-butyl N-[3-fluoro-2-[[(E)-3-[1-(3-phenylprop-2-enyl)pyrazol-3-yl]prop-2-enoyl]amino]phenyl]carbamate (PubChem CID 172858172) has the molecular formula C26H27FN4O3 and a molecular weight of 462.53 g/mol. Its IUPAC name is tert-butyl N-[3-fluoro-2-[[(E)-3-[1-(3-phenylprop-2-enyl)pyrazol-3-yl]prop-2-enoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-fluoro-2-[[(E)-3-[1-(3-phenylprop-2-enyl)pyrazol-3-yl]prop-2-enoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 172858172 |
| Molecular Formula | C26H27FN4O3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | tert-butyl N-[3-fluoro-2-[[(E)-3-[1-(3-phenylprop-2-enyl)pyrazol-3-yl]prop-2-enoyl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(F)c1NC(=O)/C=C/c1ccn(CC=Cc2ccccc2)n1 |
| InChI | InChI=1S/C26H27FN4O3/c1-26(2,3)34-25(33)28-22-13-7-12-21(27)24(22)29-23(32)15-14-20-16-18-31(30-20)17-8-11-19-9-5-4-6-10-19/h4-16,18H,17H2,1-3H3,(H,28,33)(H,29,32)/b11-8?,15-14+ |
| InChIKey | YZNUZIBTQXUMCS-OZKPHRKMSA-N |
| XLogP | 5.73 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|