trifluorosulfanium fluoride

F4S — CID 172858443

IUPACtrifluorosulfanium fluoride
SMILESF[S+](F)F.[F-]
InChIInChI=1S/F3S.FH/c1-4(2)3;/h;1H/q+1;/p-1
InChIKeyZAKFGYRAKXPGNH-UHFFFAOYSA-M
MW108.06 g/mol
LogP-1.74
Rot. Bonds

About trifluorosulfanium fluoride

trifluorosulfanium fluoride (PubChem CID 172858443) has the molecular formula F4S and a molecular weight of 108.06 g/mol. Its IUPAC name is trifluorosulfanium fluoride.

Molecular Properties

Compound Nametrifluorosulfanium fluoride
PubChem CID172858443
Molecular FormulaF4S
Molecular Weight108.06 g/mol
Exact Mass107.97
IUPAC Nametrifluorosulfanium fluoride
SMILESF[S+](F)F.[F-]
InChIInChI=1S/F3S.FH/c1-4(2)3;/h;1H/q+1;/p-1
InChIKeyZAKFGYRAKXPGNH-UHFFFAOYSA-M
XLogP-1.74
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500108.06
LogP ≤ 5-1.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}

Analyze trifluorosulfanium fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trifluorosulfanium fluoride?
The IUPAC name of trifluorosulfanium fluoride (CID 172858443) is trifluorosulfanium fluoride.
What is the SMILES notation for trifluorosulfanium fluoride?
The canonical SMILES for trifluorosulfanium fluoride is F[S+](F)F.[F-].
What is the InChIKey of trifluorosulfanium fluoride?
The InChIKey is ZAKFGYRAKXPGNH-UHFFFAOYSA-M. The full InChI is InChI=1S/F3S.FH/c1-4(2)3;/h;1H/q+1;/p-1.
What are the key properties of trifluorosulfanium fluoride?
trifluorosulfanium fluoride has a molecular weight of 108.06 g/mol, XLogP of -1.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trifluorosulfanium fluoride is sourced from PubChem (CID 172858443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).