C5H10N4O6 — CID 172860093
7,9-dihydro-3H-purine-2,6,8-trione;trihydrate (PubChem CID 172860093) has the molecular formula C5H10N4O6 and a molecular weight of 222.16 g/mol. Its IUPAC name is 7,9-dihydro-3H-purine-2,6,8-trione;trihydrate.
| Compound Name | 7,9-dihydro-3H-purine-2,6,8-trione;trihydrate |
|---|---|
| PubChem CID | 172860093 |
| Molecular Formula | C5H10N4O6 |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 7,9-dihydro-3H-purine-2,6,8-trione;trihydrate |
| SMILES | O.O.O.O=c1[nH]c(=O)c2[nH]c(=O)[nH]c2[nH]1 |
| InChI | InChI=1S/C5H4N4O3.3H2O/c10-3-1-2(7-4(11)6-1)8-5(12)9-3;;;/h(H4,6,7,8,9,10,11,12);3*1H2 |
| InChIKey | ZFRIJRONYQDBHI-UHFFFAOYSA-N |
| XLogP | -4.24 |
| TPSA | 208.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | -4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |