C26H60N2O8Si2 — CID 172860148
N',N'-bis[3-(2,2,2-triethoxyethoxysilyl)propyl]butane-1,4-diamine (PubChem CID 172860148) has the molecular formula C26H60N2O8Si2 and a molecular weight of 584.94 g/mol. Its IUPAC name is N',N'-bis[3-(2,2,2-triethoxyethoxysilyl)propyl]butane-1,4-diamine.
| Compound Name | N',N'-bis[3-(2,2,2-triethoxyethoxysilyl)propyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 172860148 |
| Molecular Formula | C26H60N2O8Si2 |
| Molecular Weight | 584.94 g/mol |
| Exact Mass | 584.39 |
| IUPAC Name | N',N'-bis[3-(2,2,2-triethoxyethoxysilyl)propyl]butane-1,4-diamine |
| SMILES | CCOC(CO[SiH2]CCCN(CCCCN)CCC[SiH2]OCC(OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C26H60N2O8Si2/c1-7-29-25(30-8-2,31-9-3)23-35-37-21-15-19-28(18-14-13-17-27)20-16-22-38-36-24-26(32-10-4,33-11-5)34-12-6/h7-24,27,37-38H2,1-6H3 |
| InChIKey | ZFWKOLHAGSLKBE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.94 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|