C22H22N5O3S+ — CID 172860385
tert-butyl 2-amino-4-[2-(phenylcarbamoyl)imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-1-ium-1-carboxylate (PubChem CID 172860385) has the molecular formula C22H22N5O3S+ and a molecular weight of 436.52 g/mol. Its IUPAC name is tert-butyl 2-amino-4-[2-(phenylcarbamoyl)imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-1-ium-1-carboxylate.
| Compound Name | tert-butyl 2-amino-4-[2-(phenylcarbamoyl)imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 172860385 |
| Molecular Formula | C22H22N5O3S+ |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | tert-butyl 2-amino-4-[2-(phenylcarbamoyl)imidazo[1,2-a]pyridin-6-yl]-1,3-thiazol-1-ium-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[s+]1cc(-c2ccc3nc(C(=O)Nc4ccccc4)cn3c2)nc1N |
| InChI | InChI=1S/C22H21N5O3S/c1-22(2,3)30-21(29)31-13-17(26-20(31)23)14-9-10-18-25-16(12-27(18)11-14)19(28)24-15-7-5-4-6-8-15/h4-13H,1-3H3,(H2-,23,24,26,28)/p+1 |
| InChIKey | ZGQWPNXPTJNISA-UHFFFAOYSA-O |
| XLogP | 4.76 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|