C13H10Na2O6S2 — CID 172862154
disodium;2-(4-methylphenyl)benzene-1,3-disulfonate (PubChem CID 172862154) has the molecular formula C13H10Na2O6S2 and a molecular weight of 372.33 g/mol. Its IUPAC name is disodium;2-(4-methylphenyl)benzene-1,3-disulfonate.
| Compound Name | disodium;2-(4-methylphenyl)benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 172862154 |
| Molecular Formula | C13H10Na2O6S2 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | disodium;2-(4-methylphenyl)benzene-1,3-disulfonate |
| SMILES | Cc1ccc(-c2c(S(=O)(=O)[O-])cccc2S(=O)(=O)[O-])cc1.[Na+].[Na+] |
| InChI | InChI=1S/C13H12O6S2.2Na/c1-9-5-7-10(8-6-9)13-11(20(14,15)16)3-2-4-12(13)21(17,18)19;;/h2-8H,1H3,(H,14,15,16)(H,17,18,19);;/q;2*+1/p-2 |
| InChIKey | ZMOULGOCSKYTGR-UHFFFAOYSA-L |
| XLogP | -4.52 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | -4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|