About N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine
N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine (PubChem CID 172862616) has the molecular formula C18H14Cl2N4
and a molecular weight of 357.24 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine.
Molecular Properties
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine |
| PubChem CID | 172862616 |
| Molecular Formula | C18H14Cl2N4 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine |
| SMILES | Cc1cc2nc(NCc3ccc(Cl)c(Cl)c3)c3ccccc3n2n1 |
| InChI | InChI=1S/C18H14Cl2N4/c1-11-8-17-22-18(13-4-2-3-5-16(13)24(17)23-11)21-10-12-6-7-14(19)15(20)9-12/h2-9H,10H2,1H3,(H,21,22) |
| InChIKey | ZOELNJNYBJWRGF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine?
The IUPAC name of N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine (CID 172862616) is N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine.
What is the SMILES notation for N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine?
The canonical SMILES for N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine is Cc1cc2nc(NCc3ccc(Cl)c(Cl)c3)c3ccccc3n2n1.
What is the InChIKey of N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine?
The InChIKey is ZOELNJNYBJWRGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Cl2N4/c1-11-8-17-22-18(13-4-2-3-5-16(13)24(17)23-11)21-10-12-6-7-14(19)15(20)9-12/h2-9H,10H2,1H3,(H,21,22).
What are the key properties of N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine?
N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine has a molecular weight of 357.24 g/mol, XLogP of 5.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dichlorophenyl)methyl]-2-methylpyrazolo[1,5-a]quinazolin-5-amine is sourced from PubChem (CID 172862616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).