About aniline;azane;1,1'-biphenyl
aniline;azane;1,1'-biphenyl (PubChem CID 172863138) has the molecular formula C18H20N2
and a molecular weight of 264.37 g/mol. Its IUPAC name is aniline;azane;1,1'-biphenyl.
Molecular Properties
| Compound Name | aniline;azane;1,1'-biphenyl |
| PubChem CID | 172863138 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | aniline;azane;1,1'-biphenyl |
| SMILES | N.Nc1ccccc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C6H7N.H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-6-4-2-1-3-5-6;/h1-10H;1-5H,7H2;1H3 |
| InChIKey | UUWVSGUFVFJEHC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;azane;1,1'-biphenyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;azane;1,1'-biphenyl?
The IUPAC name of aniline;azane;1,1'-biphenyl (CID 172863138) is aniline;azane;1,1'-biphenyl.
What is the SMILES notation for aniline;azane;1,1'-biphenyl?
The canonical SMILES for aniline;azane;1,1'-biphenyl is N.Nc1ccccc1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of aniline;azane;1,1'-biphenyl?
The InChIKey is UUWVSGUFVFJEHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C6H7N.H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-6-4-2-1-3-5-6;/h1-10H;1-5H,7H2;1H3.
What are the key properties of aniline;azane;1,1'-biphenyl?
aniline;azane;1,1'-biphenyl has a molecular weight of 264.37 g/mol, XLogP of 4.78, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;azane;1,1'-biphenyl is sourced from PubChem (CID 172863138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).