About 5H-pyrrolo[2,3-b]pyridin-3-amine
5H-pyrrolo[2,3-b]pyridin-3-amine (PubChem CID 172863720) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 5H-pyrrolo[2,3-b]pyridin-3-amine.
Molecular Properties
| Compound Name | 5H-pyrrolo[2,3-b]pyridin-3-amine |
| PubChem CID | 172863720 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 5H-pyrrolo[2,3-b]pyridin-3-amine |
| SMILES | NC1=CN=C2N=CCC=C12 |
| InChI | InChI=1S/C7H7N3/c8-6-4-10-7-5(6)2-1-3-9-7/h2-4H,1,8H2 |
| InChIKey | ZRXKKCIVSJIWGG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-pyrrolo[2,3-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrrolo[2,3-b]pyridin-3-amine?
The IUPAC name of 5H-pyrrolo[2,3-b]pyridin-3-amine (CID 172863720) is 5H-pyrrolo[2,3-b]pyridin-3-amine.
What is the SMILES notation for 5H-pyrrolo[2,3-b]pyridin-3-amine?
The canonical SMILES for 5H-pyrrolo[2,3-b]pyridin-3-amine is NC1=CN=C2N=CCC=C12.
What is the InChIKey of 5H-pyrrolo[2,3-b]pyridin-3-amine?
The InChIKey is ZRXKKCIVSJIWGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c8-6-4-10-7-5(6)2-1-3-9-7/h2-4H,1,8H2.
What are the key properties of 5H-pyrrolo[2,3-b]pyridin-3-amine?
5H-pyrrolo[2,3-b]pyridin-3-amine has a molecular weight of 133.15 g/mol, XLogP of 0.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrrolo[2,3-b]pyridin-3-amine is sourced from PubChem (CID 172863720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).