C21H15F2N5O3 — CID 172864032
[1-[4-[4-[1-(cyanocarbamoyl)cyclopropyl]-2-fluorophenyl]phenyl]-4-fluoropyrazol-5-yl] carbamate (PubChem CID 172864032) has the molecular formula C21H15F2N5O3 and a molecular weight of 423.38 g/mol. Its IUPAC name is [1-[4-[4-[1-(cyanocarbamoyl)cyclopropyl]-2-fluorophenyl]phenyl]-4-fluoropyrazol-5-yl] carbamate.
| Compound Name | [1-[4-[4-[1-(cyanocarbamoyl)cyclopropyl]-2-fluorophenyl]phenyl]-4-fluoropyrazol-5-yl] carbamate |
|---|---|
| PubChem CID | 172864032 |
| Molecular Formula | C21H15F2N5O3 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | [1-[4-[4-[1-(cyanocarbamoyl)cyclopropyl]-2-fluorophenyl]phenyl]-4-fluoropyrazol-5-yl] carbamate |
| SMILES | N#CNC(=O)C1(c2ccc(-c3ccc(-n4ncc(F)c4OC(N)=O)cc3)c(F)c2)CC1 |
| InChI | InChI=1S/C21H15F2N5O3/c22-16-9-13(21(7-8-21)19(29)26-11-24)3-6-15(16)12-1-4-14(5-2-12)28-18(31-20(25)30)17(23)10-27-28/h1-6,9-10H,7-8H2,(H2,25,30)(H,26,29) |
| InChIKey | ZSXJPEDPQWIBLS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 123.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|