About 2-silylprop-2-enylsilane
2-silylprop-2-enylsilane (PubChem CID 172864445) has the molecular formula C3H10Si2
and a molecular weight of 102.28 g/mol. Its IUPAC name is 2-silylprop-2-enylsilane.
Molecular Properties
| Compound Name | 2-silylprop-2-enylsilane |
| PubChem CID | 172864445 |
| Molecular Formula | C3H10Si2 |
| Molecular Weight | 102.28 g/mol |
| Exact Mass | 102.03 |
| IUPAC Name | 2-silylprop-2-enylsilane |
| SMILES | C=C([SiH3])C[SiH3] |
| InChI | InChI=1S/C3H10Si2/c1-3(5)2-4/h1-2H2,4-5H3 |
| InChIKey | ZUICXTDMKUIGSY-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-silylprop-2-enylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-silylprop-2-enylsilane?
The IUPAC name of 2-silylprop-2-enylsilane (CID 172864445) is 2-silylprop-2-enylsilane.
What is the SMILES notation for 2-silylprop-2-enylsilane?
The canonical SMILES for 2-silylprop-2-enylsilane is C=C([SiH3])C[SiH3].
What is the InChIKey of 2-silylprop-2-enylsilane?
The InChIKey is ZUICXTDMKUIGSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10Si2/c1-3(5)2-4/h1-2H2,4-5H3.
What are the key properties of 2-silylprop-2-enylsilane?
2-silylprop-2-enylsilane has a molecular weight of 102.28 g/mol, XLogP of -1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-silylprop-2-enylsilane is sourced from PubChem (CID 172864445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).