About methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate
methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate (PubChem CID 172864464) has the molecular formula C20H24NO4+
and a molecular weight of 342.42 g/mol. Its IUPAC name is methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate |
| PubChem CID | 172864464 |
| Molecular Formula | C20H24NO4+ |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate |
| SMILES | CCc1c[n+]2c(cc1CC(=O)OC)-c1cc(OC)c(OC)cc1CC2 |
| InChI | InChI=1S/C20H24NO4/c1-5-13-12-21-7-6-14-9-18(23-2)19(24-3)11-16(14)17(21)8-15(13)10-20(22)25-4/h8-9,11-12H,5-7,10H2,1-4H3/q+1 |
| InChIKey | QEJREMALKALLDR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate?
The IUPAC name of methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate (CID 172864464) is methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate.
What is the SMILES notation for methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate?
The canonical SMILES for methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate is CCc1c[n+]2c(cc1CC(=O)OC)-c1cc(OC)c(OC)cc1CC2.
What is the InChIKey of methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate?
The InChIKey is QEJREMALKALLDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24NO4/c1-5-13-12-21-7-6-14-9-18(23-2)19(24-3)11-16(14)17(21)8-15(13)10-20(22)25-4/h8-9,11-12H,5-7,10H2,1-4H3/q+1.
What are the key properties of methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate?
methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate has a molecular weight of 342.42 g/mol, XLogP of 2.49, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-ethyl-9,10-dimethoxy-6,7-dihydrobenzo[a]quinolizin-5-ium-2-yl)acetate is sourced from PubChem (CID 172864464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).