About 2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile
2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile (PubChem CID 172864514) has the molecular formula C12H10N4
and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile |
| PubChem CID | 172864514 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile |
| SMILES | Cc1ncn(C=Cc2ccccc2C#N)n1 |
| InChI | InChI=1S/C12H10N4/c1-10-14-9-16(15-10)7-6-11-4-2-3-5-12(11)8-13/h2-7,9H,1H3 |
| InChIKey | ZUOIFONDNAIOOD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile?
The IUPAC name of 2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile (CID 172864514) is 2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile.
What is the SMILES notation for 2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile?
The canonical SMILES for 2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile is Cc1ncn(C=Cc2ccccc2C#N)n1.
What is the InChIKey of 2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile?
The InChIKey is ZUOIFONDNAIOOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4/c1-10-14-9-16(15-10)7-6-11-4-2-3-5-12(11)8-13/h2-7,9H,1H3.
What are the key properties of 2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile?
2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile has a molecular weight of 210.24 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-methyl-1,2,4-triazol-1-yl)ethenyl]benzonitrile is sourced from PubChem (CID 172864514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).