About 1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane
1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane (PubChem CID 172865059) has the molecular formula C13H17ClN2
and a molecular weight of 236.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane |
| PubChem CID | 172865059 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane |
| SMILES | Clc1ccc(C2NCCC23CCNC3)cc1 |
| InChI | InChI=1S/C13H17ClN2/c14-11-3-1-10(2-4-11)12-13(6-8-16-12)5-7-15-9-13/h1-4,12,15-16H,5-9H2 |
| InChIKey | ZWKFYGLFSGFVRK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane?
The IUPAC name of 1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane (CID 172865059) is 1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane?
The canonical SMILES for 1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane is Clc1ccc(C2NCCC23CCNC3)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane?
The InChIKey is ZWKFYGLFSGFVRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2/c14-11-3-1-10(2-4-11)12-13(6-8-16-12)5-7-15-9-13/h1-4,12,15-16H,5-9H2.
What are the key properties of 1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane?
1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane has a molecular weight of 236.75 g/mol, XLogP of 2.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-2,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 172865059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).