C21H18N4O7S — CID 172865302
6-[4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butylamino]quinoline-5,8-dione (PubChem CID 172865302) has the molecular formula C21H18N4O7S and a molecular weight of 470.46 g/mol. Its IUPAC name is 6-[4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butylamino]quinoline-5,8-dione.
| Compound Name | 6-[4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butylamino]quinoline-5,8-dione |
|---|---|
| PubChem CID | 172865302 |
| Molecular Formula | C21H18N4O7S |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 6-[4-[[4-(benzenesulfonyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]oxy]butylamino]quinoline-5,8-dione |
| SMILES | O=C1C(NCCCCOc2no[n+]([O-])c2S(=O)(=O)c2ccccc2)=CC(=O)c2ncccc21 |
| InChI | InChI=1S/C21H18N4O7S/c26-17-13-16(19(27)15-9-6-11-23-18(15)17)22-10-4-5-12-31-20-21(25(28)32-24-20)33(29,30)14-7-2-1-3-8-14/h1-3,6-9,11,13,22H,4-5,10,12H2 |
| InChIKey | ZXGQJCMSIIYAFM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 155.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|