About CID 172866092
CID 172866092 (PubChem CID 172866092) has the molecular formula C10H10FNNa2O5
and a molecular weight of 289.17 g/mol.
Molecular Properties
| Compound Name | CID 172866092 |
| PubChem CID | 172866092 |
| Molecular Formula | C10H10FNNa2O5 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | — |
| SMILES | COC(=O)CC(=O)Oc1cc(OC)ncc1F.[Na].[Na] |
| InChI | InChI=1S/C10H10FNO5.2Na/c1-15-8-3-7(6(11)5-12-8)17-10(14)4-9(13)16-2;;/h3,5H,4H2,1-2H3;; |
| InChIKey | ZZYXRMBPGRDZPO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 172866092 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172866092?
The IUPAC name of CID 172866092 (CID 172866092) is not available.
What is the SMILES notation for CID 172866092?
The canonical SMILES for CID 172866092 is COC(=O)CC(=O)Oc1cc(OC)ncc1F.[Na].[Na].
What is the InChIKey of CID 172866092?
The InChIKey is ZZYXRMBPGRDZPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO5.2Na/c1-15-8-3-7(6(11)5-12-8)17-10(14)4-9(13)16-2;;/h3,5H,4H2,1-2H3;;.
What are the key properties of CID 172866092?
CID 172866092 has a molecular weight of 289.17 g/mol, XLogP of -0.06, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172866092 is sourced from PubChem (CID 172866092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).