C21H21N5O4 — CID 172866470
(4S)-4-(4-cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1-nitroso-4H-1,6-naphthyridine-3-carboxamide (PubChem CID 172866470) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is (4S)-4-(4-cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1-nitroso-4H-1,6-naphthyridine-3-carboxamide.
| Compound Name | (4S)-4-(4-cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1-nitroso-4H-1,6-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 172866470 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (4S)-4-(4-cyano-2-methoxyphenyl)-5-ethoxy-2,8-dimethyl-1-nitroso-4H-1,6-naphthyridine-3-carboxamide |
| SMILES | CCOc1ncc(C)c2c1[C@H](c1ccc(C#N)cc1OC)C(C(N)=O)=C(C)N2N=O |
| InChI | InChI=1S/C21H21N5O4/c1-5-30-21-18-17(14-7-6-13(9-22)8-15(14)29-4)16(20(23)27)12(3)26(25-28)19(18)11(2)10-24-21/h6-8,10,17H,5H2,1-4H3,(H2,23,27)/t17-/m1/s1 |
| InChIKey | UHJMZMZTYHZJFJ-QGZVFWFLSA-N |
| XLogP | 3.06 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|