About 2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid
2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid (PubChem CID 172866686) has the molecular formula C19H14F2N2O4S
and a molecular weight of 404.39 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid |
| PubChem CID | 172866686 |
| Molecular Formula | C19H14F2N2O4S |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid |
| SMILES | Cc1c(-c2ccc([N+](=O)[O-])cc2)sc(NCc2c(F)cccc2F)c1C(=O)O |
| InChI | InChI=1S/C19H14F2N2O4S/c1-10-16(19(24)25)18(22-9-13-14(20)3-2-4-15(13)21)28-17(10)11-5-7-12(8-6-11)23(26)27/h2-8,22H,9H2,1H3,(H,24,25) |
| InChIKey | BANAPKADVSFHHN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid?
The IUPAC name of 2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid (CID 172866686) is 2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid.
What is the SMILES notation for 2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid?
The canonical SMILES for 2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid is Cc1c(-c2ccc([N+](=O)[O-])cc2)sc(NCc2c(F)cccc2F)c1C(=O)O.
What is the InChIKey of 2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid?
The InChIKey is BANAPKADVSFHHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F2N2O4S/c1-10-16(19(24)25)18(22-9-13-14(20)3-2-4-15(13)21)28-17(10)11-5-7-12(8-6-11)23(26)27/h2-8,22H,9H2,1H3,(H,24,25).
What are the key properties of 2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid?
2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid has a molecular weight of 404.39 g/mol, XLogP of 5.22, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-difluorophenyl)methylamino]-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylic acid is sourced from PubChem (CID 172866686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).