About methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate
methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate (PubChem CID 172868881) has the molecular formula C12H13ClF2N2O2
and a molecular weight of 290.70 g/mol. Its IUPAC name is methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate |
| PubChem CID | 172868881 |
| Molecular Formula | C12H13ClF2N2O2 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(Cl)cc1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H13ClF2N2O2/c1-19-11(18)8-7-16-10(13)6-9(8)17-4-2-12(14,15)3-5-17/h6-7H,2-5H2,1H3 |
| InChIKey | ONQJDLWHIPQQNM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate?
The IUPAC name of methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate (CID 172868881) is methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate.
What is the SMILES notation for methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate?
The canonical SMILES for methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate is COC(=O)c1cnc(Cl)cc1N1CCC(F)(F)CC1.
What is the InChIKey of methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate?
The InChIKey is ONQJDLWHIPQQNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClF2N2O2/c1-19-11(18)8-7-16-10(13)6-9(8)17-4-2-12(14,15)3-5-17/h6-7H,2-5H2,1H3.
What are the key properties of methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate?
methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate has a molecular weight of 290.70 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-chloro-4-(4,4-difluoropiperidin-1-yl)pyridine-3-carboxylate is sourced from PubChem (CID 172868881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).