C28H24O9 — CID 172870391
2,15-dioxapentacyclo[21.3.1.13,7.110,14.116,20]triaconta-1(26),3(30),4,6,10,12,14(29),16(28),17,19,23(27),24-dodecaene-4,5,12,13,17,18,26-heptol (PubChem CID 172870391) has the molecular formula C28H24O9 and a molecular weight of 504.49 g/mol. Its IUPAC name is 2,15-dioxapentacyclo[21.3.1.13,7.110,14.116,20]triaconta-1(26),3(30),4,6,10,12,14(29),16(28),17,19,23(27),24-dodecaene-4,5,12,13,17,18,26-heptol.
| Compound Name | 2,15-dioxapentacyclo[21.3.1.13,7.110,14.116,20]triaconta-1(26),3(30),4,6,10,12,14(29),16(28),17,19,23(27),24-dodecaene-4,5,12,13,17,18,26-heptol |
|---|---|
| PubChem CID | 172870391 |
| Molecular Formula | C28H24O9 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 2,15-dioxapentacyclo[21.3.1.13,7.110,14.116,20]triaconta-1(26),3(30),4,6,10,12,14(29),16(28),17,19,23(27),24-dodecaene-4,5,12,13,17,18,26-heptol |
| SMILES | Oc1ccc2cc1Oc1cc(cc(O)c1O)CCc1cc(O)c(O)c(c1)Oc1cc(cc(O)c1O)CC2 |
| InChI | InChI=1S/C28H24O9/c29-18-6-5-14-1-2-15-7-20(31)27(34)24(12-15)37-25-13-17(9-21(32)28(25)35)4-3-16-8-19(30)26(33)23(11-16)36-22(18)10-14/h5-13,29-35H,1-4H2 |
| InChIKey | ARENFSSFDKZRBL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|