C30H26O10 — CID 172870634
4-[4,5-dihydroxy-2-[2-(7-hydroxy-1,3-benzodioxol-5-yl)ethyl]phenyl]-5-[2-(7-hydroxy-1,3-benzodioxol-5-yl)ethyl]benzene-1,2-diol (PubChem CID 172870634) has the molecular formula C30H26O10 and a molecular weight of 546.53 g/mol. Its IUPAC name is 4-[4,5-dihydroxy-2-[2-(7-hydroxy-1,3-benzodioxol-5-yl)ethyl]phenyl]-5-[2-(7-hydroxy-1,3-benzodioxol-5-yl)ethyl]benzene-1,2-diol.
| Compound Name | 4-[4,5-dihydroxy-2-[2-(7-hydroxy-1,3-benzodioxol-5-yl)ethyl]phenyl]-5-[2-(7-hydroxy-1,3-benzodioxol-5-yl)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 172870634 |
| Molecular Formula | C30H26O10 |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 4-[4,5-dihydroxy-2-[2-(7-hydroxy-1,3-benzodioxol-5-yl)ethyl]phenyl]-5-[2-(7-hydroxy-1,3-benzodioxol-5-yl)ethyl]benzene-1,2-diol |
| SMILES | Oc1cc(CCc2cc(O)c3c(c2)OCO3)c(-c2cc(O)c(O)cc2CCc2cc(O)c3c(c2)OCO3)cc1O |
| InChI | InChI=1S/C30H26O10/c31-21-9-17(3-1-15-5-25(35)29-27(7-15)37-13-39-29)19(11-23(21)33)20-12-24(34)22(32)10-18(20)4-2-16-6-26(36)30-28(8-16)38-14-40-30/h5-12,31-36H,1-4,13-14H2 |
| InChIKey | JEBGNCDJISXUGB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|